C13H10BrFN2O — CID 107594820
4-(bromomethyl)-N-(3-fluoro-4-pyridinyl)benzamide (PubChem CID 107594820) has the molecular formula C13H10BrFN2O and a molecular weight of 309.14 g/mol. Its IUPAC name is 4-(bromomethyl)-N-(3-fluoro-4-pyridinyl)benzamide.
| Compound Name | 4-(bromomethyl)-N-(3-fluoro-4-pyridinyl)benzamide |
|---|---|
| PubChem CID | 107594820 |
| Molecular Formula | C13H10BrFN2O |
| Molecular Weight | 309.14 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 4-(bromomethyl)-N-(3-fluoro-4-pyridinyl)benzamide |
| SMILES | O=C(Nc1ccncc1F)c1ccc(CBr)cc1 |
| InChI | InChI=1S/C13H10BrFN2O/c14-7-9-1-3-10(4-2-9)13(18)17-12-5-6-16-8-11(12)15/h1-6,8H,7H2,(H,16,17,18) |
| InChIKey | YHWYGCXRORWDOO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.14 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|