C21H20FN5O2 — CID 44594972
N-(3-amino-4-pyridinyl)-4-[[(4-fluorophenyl)methylcarbamoylamino]methyl]benzamide (PubChem CID 44594972) has the molecular formula C21H20FN5O2 and a molecular weight of 393.42 g/mol. Its IUPAC name is N-(3-amino-4-pyridinyl)-4-[[(4-fluorophenyl)methylcarbamoylamino]methyl]benzamide.
| Compound Name | N-(3-amino-4-pyridinyl)-4-[[(4-fluorophenyl)methylcarbamoylamino]methyl]benzamide |
|---|---|
| PubChem CID | 44594972 |
| Molecular Formula | C21H20FN5O2 |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | N-(3-amino-4-pyridinyl)-4-[[(4-fluorophenyl)methylcarbamoylamino]methyl]benzamide |
| SMILES | Nc1cnccc1NC(=O)c1ccc(CNC(=O)NCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H20FN5O2/c22-17-7-3-15(4-8-17)12-26-21(29)25-11-14-1-5-16(6-2-14)20(28)27-19-9-10-24-13-18(19)23/h1-10,13H,11-12,23H2,(H,24,27,28)(H2,25,26,29) |
| InChIKey | UDMHIDOMHVSORE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |