C22H19FN4O2 — CID 69060444
N-(2-amino-4-fluorophenyl)-4-[(2-pyridin-3-ylprop-2-enoylamino)methyl]benzamide (PubChem CID 69060444) has the molecular formula C22H19FN4O2 and a molecular weight of 390.42 g/mol. Its IUPAC name is N-(2-amino-4-fluorophenyl)-4-[(2-pyridin-3-ylprop-2-enoylamino)methyl]benzamide.
| Compound Name | N-(2-amino-4-fluorophenyl)-4-[(2-pyridin-3-ylprop-2-enoylamino)methyl]benzamide |
|---|---|
| PubChem CID | 69060444 |
| Molecular Formula | C22H19FN4O2 |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | N-(2-amino-4-fluorophenyl)-4-[(2-pyridin-3-ylprop-2-enoylamino)methyl]benzamide |
| SMILES | C=C(C(=O)NCc1ccc(C(=O)Nc2ccc(F)cc2N)cc1)c1cccnc1 |
| InChI | InChI=1S/C22H19FN4O2/c1-14(17-3-2-10-25-13-17)21(28)26-12-15-4-6-16(7-5-15)22(29)27-20-9-8-18(23)11-19(20)24/h2-11,13H,1,12,24H2,(H,26,28)(H,27,29) |
| InChIKey | ZRCZTRLCLKRERQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|