C21H20FN5O2 — CID 68846360
N-(2-amino-5-fluorophenyl)-4-[[[methyl(pyridin-3-yl)carbamoyl]amino]methyl]benzamide (PubChem CID 68846360) has the molecular formula C21H20FN5O2 and a molecular weight of 393.42 g/mol. Its IUPAC name is N-(2-amino-5-fluorophenyl)-4-[[[methyl(pyridin-3-yl)carbamoyl]amino]methyl]benzamide.
| Compound Name | N-(2-amino-5-fluorophenyl)-4-[[[methyl(pyridin-3-yl)carbamoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 68846360 |
| Molecular Formula | C21H20FN5O2 |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | N-(2-amino-5-fluorophenyl)-4-[[[methyl(pyridin-3-yl)carbamoyl]amino]methyl]benzamide |
| SMILES | CN(C(=O)NCc1ccc(C(=O)Nc2cc(F)ccc2N)cc1)c1cccnc1 |
| InChI | InChI=1S/C21H20FN5O2/c1-27(17-3-2-10-24-13-17)21(29)25-12-14-4-6-15(7-5-14)20(28)26-19-11-16(22)8-9-18(19)23/h2-11,13H,12,23H2,1H3,(H,25,29)(H,26,28) |
| InChIKey | ACWQYADKGAOWCC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|