C22H22FN5O2 — CID 59932620
N-(2-amino-5-fluorophenyl)-4-[(1-pyridin-3-ylethylcarbamoylamino)methyl]benzamide (PubChem CID 59932620) has the molecular formula C22H22FN5O2 and a molecular weight of 407.45 g/mol. Its IUPAC name is N-(2-amino-5-fluorophenyl)-4-[(1-pyridin-3-ylethylcarbamoylamino)methyl]benzamide.
| Compound Name | N-(2-amino-5-fluorophenyl)-4-[(1-pyridin-3-ylethylcarbamoylamino)methyl]benzamide |
|---|---|
| PubChem CID | 59932620 |
| Molecular Formula | C22H22FN5O2 |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N-(2-amino-5-fluorophenyl)-4-[(1-pyridin-3-ylethylcarbamoylamino)methyl]benzamide |
| SMILES | CC(NC(=O)NCc1ccc(C(=O)Nc2cc(F)ccc2N)cc1)c1cccnc1 |
| InChI | InChI=1S/C22H22FN5O2/c1-14(17-3-2-10-25-13-17)27-22(30)26-12-15-4-6-16(7-5-15)21(29)28-20-11-18(23)8-9-19(20)24/h2-11,13-14H,12,24H2,1H3,(H,28,29)(H2,26,27,30) |
| InChIKey | WJMPYMULABZCSH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|