C25H20FN3O2 — CID 71478084
N-[[4-[(2-amino-5-fluorophenyl)carbamoyl]phenyl]methyl]naphthalene-1-carboxamide (PubChem CID 71478084) has the molecular formula C25H20FN3O2 and a molecular weight of 413.45 g/mol. Its IUPAC name is N-[[4-[(2-amino-5-fluorophenyl)carbamoyl]phenyl]methyl]naphthalene-1-carboxamide.
| Compound Name | N-[[4-[(2-amino-5-fluorophenyl)carbamoyl]phenyl]methyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 71478084 |
| Molecular Formula | C25H20FN3O2 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | N-[[4-[(2-amino-5-fluorophenyl)carbamoyl]phenyl]methyl]naphthalene-1-carboxamide |
| SMILES | Nc1ccc(F)cc1NC(=O)c1ccc(CNC(=O)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C25H20FN3O2/c26-19-12-13-22(27)23(14-19)29-24(30)18-10-8-16(9-11-18)15-28-25(31)21-7-3-5-17-4-1-2-6-20(17)21/h1-14H,15,27H2,(H,28,31)(H,29,30) |
| InChIKey | NPXNZBRXWZAORW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|