C24H19FN2O3 — CID 160852320
N-(2-amino-5-fluorophenyl)-4-[3-(1-benzofuran-2-yl)-3-oxopropyl]benzamide (PubChem CID 160852320) has the molecular formula C24H19FN2O3 and a molecular weight of 402.43 g/mol. Its IUPAC name is N-(2-amino-5-fluorophenyl)-4-[3-(1-benzofuran-2-yl)-3-oxopropyl]benzamide.
| Compound Name | N-(2-amino-5-fluorophenyl)-4-[3-(1-benzofuran-2-yl)-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 160852320 |
| Molecular Formula | C24H19FN2O3 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | N-(2-amino-5-fluorophenyl)-4-[3-(1-benzofuran-2-yl)-3-oxopropyl]benzamide |
| SMILES | Nc1ccc(F)cc1NC(=O)c1ccc(CCC(=O)c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C24H19FN2O3/c25-18-10-11-19(26)20(14-18)27-24(29)16-8-5-15(6-9-16)7-12-21(28)23-13-17-3-1-2-4-22(17)30-23/h1-6,8-11,13-14H,7,12,26H2,(H,27,29) |
| InChIKey | SJKNNLGRYMAOKL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|