C21H20N6O4 — CID 44594969
N-(3-amino-4-pyridinyl)-4-[[(4-nitrophenyl)methylcarbamoylamino]methyl]benzamide (PubChem CID 44594969) has the molecular formula C21H20N6O4 and a molecular weight of 420.43 g/mol. Its IUPAC name is N-(3-amino-4-pyridinyl)-4-[[(4-nitrophenyl)methylcarbamoylamino]methyl]benzamide.
| Compound Name | N-(3-amino-4-pyridinyl)-4-[[(4-nitrophenyl)methylcarbamoylamino]methyl]benzamide |
|---|---|
| PubChem CID | 44594969 |
| Molecular Formula | C21H20N6O4 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | N-(3-amino-4-pyridinyl)-4-[[(4-nitrophenyl)methylcarbamoylamino]methyl]benzamide |
| SMILES | Nc1cnccc1NC(=O)c1ccc(CNC(=O)NCc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C21H20N6O4/c22-18-13-23-10-9-19(18)26-20(28)16-5-1-14(2-6-16)11-24-21(29)25-12-15-3-7-17(8-4-15)27(30)31/h1-10,13H,11-12,22H2,(H,23,26,28)(H2,24,25,29) |
| InChIKey | BHXGINWDEYNNEG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 152.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|