C21H26FN4O2S+ — CID 9214441
N-(3-fluorophenyl)-2-[4-[(4-methoxyphenyl)methylcarbamothioyl]piperazin-1-ium-1-yl]acetamide (PubChem CID 9214441) has the molecular formula C21H26FN4O2S+ and a molecular weight of 417.53 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[4-[(4-methoxyphenyl)methylcarbamothioyl]piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(3-fluorophenyl)-2-[4-[(4-methoxyphenyl)methylcarbamothioyl]piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9214441 |
| Molecular Formula | C21H26FN4O2S+ |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | N-(3-fluorophenyl)-2-[4-[(4-methoxyphenyl)methylcarbamothioyl]piperazin-1-ium-1-yl]acetamide |
| SMILES | COc1ccc(CNC(=S)N2CC[NH+](CC(=O)Nc3cccc(F)c3)CC2)cc1 |
| InChI | InChI=1S/C21H25FN4O2S/c1-28-19-7-5-16(6-8-19)14-23-21(29)26-11-9-25(10-12-26)15-20(27)24-18-4-2-3-17(22)13-18/h2-8,13H,9-12,14-15H2,1H3,(H,23,29)(H,24,27)/p+1 |
| InChIKey | LCRPKCYLFZDKQI-UHFFFAOYSA-O |
| XLogP | 1.05 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|