C21H25FN3O3+ — CID 9020166
N-(3-fluorophenyl)-2-[4-[2-(3-methoxyphenyl)acetyl]piperazin-1-ium-1-yl]acetamide (PubChem CID 9020166) has the molecular formula C21H25FN3O3+ and a molecular weight of 386.45 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[4-[2-(3-methoxyphenyl)acetyl]piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(3-fluorophenyl)-2-[4-[2-(3-methoxyphenyl)acetyl]piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9020166 |
| Molecular Formula | C21H25FN3O3+ |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | N-(3-fluorophenyl)-2-[4-[2-(3-methoxyphenyl)acetyl]piperazin-1-ium-1-yl]acetamide |
| SMILES | COc1cccc(CC(=O)N2CC[NH+](CC(=O)Nc3cccc(F)c3)CC2)c1 |
| InChI | InChI=1S/C21H24FN3O3/c1-28-19-7-2-4-16(12-19)13-21(27)25-10-8-24(9-11-25)15-20(26)23-18-6-3-5-17(22)14-18/h2-7,12,14H,8-11,13,15H2,1H3,(H,23,26)/p+1 |
| InChIKey | HZMOUGVIZGKKPT-UHFFFAOYSA-O |
| XLogP | 0.74 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |