C18H23FN5O4+ — CID 9225284
N-(3-fluorophenyl)-2-[4-[2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]piperazin-1-ium-1-yl]acetamide (PubChem CID 9225284) has the molecular formula C18H23FN5O4+ and a molecular weight of 392.41 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[4-[2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(3-fluorophenyl)-2-[4-[2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9225284 |
| Molecular Formula | C18H23FN5O4+ |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-(3-fluorophenyl)-2-[4-[2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]piperazin-1-ium-1-yl]acetamide |
| SMILES | CN1CC(=O)N(CC(=O)N2CC[NH+](CC(=O)Nc3cccc(F)c3)CC2)C1=O |
| InChI | InChI=1S/C18H22FN5O4/c1-21-11-17(27)24(18(21)28)12-16(26)23-7-5-22(6-8-23)10-15(25)20-14-4-2-3-13(19)9-14/h2-4,9H,5-8,10-12H2,1H3,(H,20,25)/p+1 |
| InChIKey | HRCZIDSRKWKAMY-UHFFFAOYSA-O |
| XLogP | -1.61 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|