C12H16FN2O2+ — CID 2654034
N-(3-fluorophenyl)-2-morpholin-4-ium-4-ylacetamide (PubChem CID 2654034) has the molecular formula C12H16FN2O2+ and a molecular weight of 239.27 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-morpholin-4-ium-4-ylacetamide.
| Compound Name | N-(3-fluorophenyl)-2-morpholin-4-ium-4-ylacetamide |
|---|---|
| PubChem CID | 2654034 |
| Molecular Formula | C12H16FN2O2+ |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | N-(3-fluorophenyl)-2-morpholin-4-ium-4-ylacetamide |
| SMILES | O=C(C[NH+]1CCOCC1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C12H15FN2O2/c13-10-2-1-3-11(8-10)14-12(16)9-15-4-6-17-7-5-15/h1-3,8H,4-7,9H2,(H,14,16)/p+1 |
| InChIKey | GPLDJFZAUDSSMX-UHFFFAOYSA-O |
| XLogP | -0.32 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |