C13H18FN2O2+ — CID 9275850
(2R)-N-(3-fluorophenyl)-2-morpholin-4-ium-4-ylpropanamide (PubChem CID 9275850) has the molecular formula C13H18FN2O2+ and a molecular weight of 253.30 g/mol. Its IUPAC name is (2R)-N-(3-fluorophenyl)-2-morpholin-4-ium-4-ylpropanamide.
| Compound Name | (2R)-N-(3-fluorophenyl)-2-morpholin-4-ium-4-ylpropanamide |
|---|---|
| PubChem CID | 9275850 |
| Molecular Formula | C13H18FN2O2+ |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | (2R)-N-(3-fluorophenyl)-2-morpholin-4-ium-4-ylpropanamide |
| SMILES | C[C@H](C(=O)Nc1cccc(F)c1)[NH+]1CCOCC1 |
| InChI | InChI=1S/C13H17FN2O2/c1-10(16-5-7-18-8-6-16)13(17)15-12-4-2-3-11(14)9-12/h2-4,9-10H,5-8H2,1H3,(H,15,17)/p+1/t10-/m1/s1 |
| InChIKey | VDYUNMJZEGQVGX-SNVBAGLBSA-O |
| XLogP | 0.07 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |