C15H23N2O2+ — CID 9275992
(2S)-N-(2,6-dimethylphenyl)-2-morpholin-4-ium-4-ylpropanamide (PubChem CID 9275992) has the molecular formula C15H23N2O2+ and a molecular weight of 263.36 g/mol. Its IUPAC name is (2S)-N-(2,6-dimethylphenyl)-2-morpholin-4-ium-4-ylpropanamide.
| Compound Name | (2S)-N-(2,6-dimethylphenyl)-2-morpholin-4-ium-4-ylpropanamide |
|---|---|
| PubChem CID | 9275992 |
| Molecular Formula | C15H23N2O2+ |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.18 |
| IUPAC Name | (2S)-N-(2,6-dimethylphenyl)-2-morpholin-4-ium-4-ylpropanamide |
| SMILES | Cc1cccc(C)c1NC(=O)[C@H](C)[NH+]1CCOCC1 |
| InChI | InChI=1S/C15H22N2O2/c1-11-5-4-6-12(2)14(11)16-15(18)13(3)17-7-9-19-10-8-17/h4-6,13H,7-10H2,1-3H3,(H,16,18)/p+1/t13-/m0/s1 |
| InChIKey | GLMJESDHTWLHAP-ZDUSSCGKSA-O |
| XLogP | 0.55 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |