C12H15F2N2O2+ — CID 2654003
N-(3,4-difluorophenyl)-2-morpholin-4-ium-4-ylacetamide (PubChem CID 2654003) has the molecular formula C12H15F2N2O2+ and a molecular weight of 257.26 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-morpholin-4-ium-4-ylacetamide.
| Compound Name | N-(3,4-difluorophenyl)-2-morpholin-4-ium-4-ylacetamide |
|---|---|
| PubChem CID | 2654003 |
| Molecular Formula | C12H15F2N2O2+ |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-morpholin-4-ium-4-ylacetamide |
| SMILES | O=C(C[NH+]1CCOCC1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H14F2N2O2/c13-10-2-1-9(7-11(10)14)15-12(17)8-16-3-5-18-6-4-16/h1-2,7H,3-6,8H2,(H,15,17)/p+1 |
| InChIKey | FOPWIOVSTIEYAL-UHFFFAOYSA-O |
| XLogP | -0.18 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |