C19H19Cl2FN3O2+ — CID 9020364
2-[4-(3,4-dichlorobenzoyl)piperazin-1-ium-1-yl]-N-(3-fluorophenyl)acetamide (PubChem CID 9020364) has the molecular formula C19H19Cl2FN3O2+ and a molecular weight of 411.28 g/mol. Its IUPAC name is 2-[4-(3,4-dichlorobenzoyl)piperazin-1-ium-1-yl]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[4-(3,4-dichlorobenzoyl)piperazin-1-ium-1-yl]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 9020364 |
| Molecular Formula | C19H19Cl2FN3O2+ |
| Molecular Weight | 411.28 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 2-[4-(3,4-dichlorobenzoyl)piperazin-1-ium-1-yl]-N-(3-fluorophenyl)acetamide |
| SMILES | O=C(C[NH+]1CCN(C(=O)c2ccc(Cl)c(Cl)c2)CC1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C19H18Cl2FN3O2/c20-16-5-4-13(10-17(16)21)19(27)25-8-6-24(7-9-25)12-18(26)23-15-3-1-2-14(22)11-15/h1-5,10-11H,6-9,12H2,(H,23,26)/p+1 |
| InChIKey | HHGDMUUXIQAIQR-UHFFFAOYSA-O |
| XLogP | 2.11 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |