C21H32FN4O4+ — CID 9225296
tert-butyl N-[4-[4-[2-(3-fluoroanilino)-2-oxoethyl]piperazin-4-ium-1-yl]-4-oxobutyl]carbamate (PubChem CID 9225296) has the molecular formula C21H32FN4O4+ and a molecular weight of 423.51 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[2-(3-fluoroanilino)-2-oxoethyl]piperazin-4-ium-1-yl]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[2-(3-fluoroanilino)-2-oxoethyl]piperazin-4-ium-1-yl]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 9225296 |
| Molecular Formula | C21H32FN4O4+ |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | tert-butyl N-[4-[4-[2-(3-fluoroanilino)-2-oxoethyl]piperazin-4-ium-1-yl]-4-oxobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)N1CC[NH+](CC(=O)Nc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C21H31FN4O4/c1-21(2,3)30-20(29)23-9-5-8-19(28)26-12-10-25(11-13-26)15-18(27)24-17-7-4-6-16(22)14-17/h4,6-7,14H,5,8-13,15H2,1-3H3,(H,23,29)(H,24,27)/p+1 |
| InChIKey | ZBIGXUKKHHJQOC-UHFFFAOYSA-O |
| XLogP | 0.80 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|