C17H23N4O2S+ — CID 8600516
N-(3-methoxyphenyl)-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazin-4-ium-1-carbothioamide (PubChem CID 8600516) has the molecular formula C17H23N4O2S+ and a molecular weight of 347.46 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazin-4-ium-1-carbothioamide.
| Compound Name | N-(3-methoxyphenyl)-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 8600516 |
| Molecular Formula | C17H23N4O2S+ |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | N-(3-methoxyphenyl)-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazin-4-ium-1-carbothioamide |
| SMILES | COc1cccc(NC(=S)N2CC[NH+](Cc3cc(C)on3)CC2)c1 |
| InChI | InChI=1S/C17H22N4O2S/c1-13-10-15(19-23-13)12-20-6-8-21(9-7-20)17(24)18-14-4-3-5-16(11-14)22-2/h3-5,10-11H,6-9,12H2,1-2H3,(H,18,24)/p+1 |
| InChIKey | LEDHMMOCISXPAD-UHFFFAOYSA-O |
| XLogP | 1.09 |
| TPSA | 54.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|