C16H19ClN5O3S+ — CID 9284447
N-(2-chloro-5-nitrophenyl)-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazin-4-ium-1-carbothioamide (PubChem CID 9284447) has the molecular formula C16H19ClN5O3S+ and a molecular weight of 396.88 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazin-4-ium-1-carbothioamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 9284447 |
| Molecular Formula | C16H19ClN5O3S+ |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazin-4-ium-1-carbothioamide |
| SMILES | Cc1cc(C[NH+]2CCN(C(=S)Nc3cc([N+](=O)[O-])ccc3Cl)CC2)no1 |
| InChI | InChI=1S/C16H18ClN5O3S/c1-11-8-12(19-25-11)10-20-4-6-21(7-5-20)16(26)18-15-9-13(22(23)24)2-3-14(15)17/h2-3,8-9H,4-7,10H2,1H3,(H,18,26)/p+1 |
| InChIKey | QJPLWSGQFXACJA-UHFFFAOYSA-O |
| XLogP | 1.64 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|