C16H17ClN4O2S — CID 8771119
(1S)-N-(2-chloro-5-nitrophenyl)-1,6-dimethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide (PubChem CID 8771119) has the molecular formula C16H17ClN4O2S and a molecular weight of 364.86 g/mol. Its IUPAC name is (1S)-N-(2-chloro-5-nitrophenyl)-1,6-dimethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide.
| Compound Name | (1S)-N-(2-chloro-5-nitrophenyl)-1,6-dimethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide |
|---|---|
| PubChem CID | 8771119 |
| Molecular Formula | C16H17ClN4O2S |
| Molecular Weight | 364.86 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | (1S)-N-(2-chloro-5-nitrophenyl)-1,6-dimethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide |
| SMILES | Cc1ccc2n1CCN(C(=S)Nc1cc([N+](=O)[O-])ccc1Cl)[C@H]2C |
| InChI | InChI=1S/C16H17ClN4O2S/c1-10-3-6-15-11(2)20(8-7-19(10)15)16(24)18-14-9-12(21(22)23)4-5-13(14)17/h3-6,9,11H,7-8H2,1-2H3,(H,18,24)/t11-/m0/s1 |
| InChIKey | DPDAETCOSHPXRT-NSHDSACASA-N |
| XLogP | 4.13 |
| TPSA | 63.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.86 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|