C13H13ClF3N3O2S — CID 2459545
(3S)-N-(2-chloro-5-nitrophenyl)-3-(trifluoromethyl)piperidine-1-carbothioamide (PubChem CID 2459545) has the molecular formula C13H13ClF3N3O2S and a molecular weight of 367.78 g/mol. Its IUPAC name is (3S)-N-(2-chloro-5-nitrophenyl)-3-(trifluoromethyl)piperidine-1-carbothioamide.
| Compound Name | (3S)-N-(2-chloro-5-nitrophenyl)-3-(trifluoromethyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 2459545 |
| Molecular Formula | C13H13ClF3N3O2S |
| Molecular Weight | 367.78 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | (3S)-N-(2-chloro-5-nitrophenyl)-3-(trifluoromethyl)piperidine-1-carbothioamide |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(NC(=S)N2CCC[C@H](C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C13H13ClF3N3O2S/c14-10-4-3-9(20(21)22)6-11(10)18-12(23)19-5-1-2-8(7-19)13(15,16)17/h3-4,6,8H,1-2,5,7H2,(H,18,23)/t8-/m0/s1 |
| InChIKey | TWCNEVUBFXELAK-QMMMGPOBSA-N |
| XLogP | 4.22 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.78 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|