C18H19ClN4O2S — CID 9284295
(2R)-N-(2-chloro-5-nitrophenyl)-4-methyl-2-phenylpiperazine-1-carbothioamide (PubChem CID 9284295) has the molecular formula C18H19ClN4O2S and a molecular weight of 390.90 g/mol. Its IUPAC name is (2R)-N-(2-chloro-5-nitrophenyl)-4-methyl-2-phenylpiperazine-1-carbothioamide.
| Compound Name | (2R)-N-(2-chloro-5-nitrophenyl)-4-methyl-2-phenylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 9284295 |
| Molecular Formula | C18H19ClN4O2S |
| Molecular Weight | 390.90 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | (2R)-N-(2-chloro-5-nitrophenyl)-4-methyl-2-phenylpiperazine-1-carbothioamide |
| SMILES | CN1CCN(C(=S)Nc2cc([N+](=O)[O-])ccc2Cl)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C18H19ClN4O2S/c1-21-9-10-22(17(12-21)13-5-3-2-4-6-13)18(26)20-16-11-14(23(24)25)7-8-15(16)19/h2-8,11,17H,9-10,12H2,1H3,(H,20,26)/t17-/m0/s1 |
| InChIKey | BWLUMJAAKRCBAW-KRWDZBQOSA-N |
| XLogP | 3.93 |
| TPSA | 61.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.90 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|