C20H17ClN4O2S — CID 7136290
(1S)-N-(2-chlorophenyl)-1-(3-nitrophenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide (PubChem CID 7136290) has the molecular formula C20H17ClN4O2S and a molecular weight of 412.90 g/mol. Its IUPAC name is (1S)-N-(2-chlorophenyl)-1-(3-nitrophenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide.
| Compound Name | (1S)-N-(2-chlorophenyl)-1-(3-nitrophenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide |
|---|---|
| PubChem CID | 7136290 |
| Molecular Formula | C20H17ClN4O2S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | (1S)-N-(2-chlorophenyl)-1-(3-nitrophenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide |
| SMILES | O=[N+]([O-])c1cccc([C@H]2c3cccn3CCN2C(=S)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C20H17ClN4O2S/c21-16-7-1-2-8-17(16)22-20(28)24-12-11-23-10-4-9-18(23)19(24)14-5-3-6-15(13-14)25(26)27/h1-10,13,19H,11-12H2,(H,22,28)/t19-/m0/s1 |
| InChIKey | OXQUWVGANQUSHR-IBGZPJMESA-N |
| XLogP | 4.85 |
| TPSA | 63.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|