C21H17F3N4O2S — CID 43948731
1-(4-nitrophenyl)-N-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide (PubChem CID 43948731) has the molecular formula C21H17F3N4O2S and a molecular weight of 446.45 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-N-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide.
| Compound Name | 1-(4-nitrophenyl)-N-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide |
|---|---|
| PubChem CID | 43948731 |
| Molecular Formula | C21H17F3N4O2S |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 1-(4-nitrophenyl)-N-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide |
| SMILES | O=[N+]([O-])c1ccc(C2c3cccn3CCN2C(=S)Nc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H17F3N4O2S/c22-21(23,24)15-5-7-16(8-6-15)25-20(31)27-13-12-26-11-1-2-18(26)19(27)14-3-9-17(10-4-14)28(29)30/h1-11,19H,12-13H2,(H,25,31) |
| InChIKey | QWZKIDSPNCUFII-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 63.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|