C24H26N3OS+ — CID 7237332
4-benzyl-N-(4-phenoxyphenyl)piperazin-4-ium-1-carbothioamide (PubChem CID 7237332) has the molecular formula C24H26N3OS+ and a molecular weight of 404.56 g/mol. Its IUPAC name is 4-benzyl-N-(4-phenoxyphenyl)piperazin-4-ium-1-carbothioamide.
| Compound Name | 4-benzyl-N-(4-phenoxyphenyl)piperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 7237332 |
| Molecular Formula | C24H26N3OS+ |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 4-benzyl-N-(4-phenoxyphenyl)piperazin-4-ium-1-carbothioamide |
| SMILES | S=C(Nc1ccc(Oc2ccccc2)cc1)N1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H25N3OS/c29-24(27-17-15-26(16-18-27)19-20-7-3-1-4-8-20)25-21-11-13-23(14-12-21)28-22-9-5-2-6-10-22/h1-14H,15-19H2,(H,25,29)/p+1 |
| InChIKey | XEHPFQGYJFBRMW-UHFFFAOYSA-O |
| XLogP | 3.58 |
| TPSA | 28.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|