C18H20Cl2N3O+ — CID 7359826
4-benzyl-N-(3,4-dichlorophenyl)piperazin-4-ium-1-carboxamide (PubChem CID 7359826) has the molecular formula C18H20Cl2N3O+ and a molecular weight of 365.28 g/mol. Its IUPAC name is 4-benzyl-N-(3,4-dichlorophenyl)piperazin-4-ium-1-carboxamide.
| Compound Name | 4-benzyl-N-(3,4-dichlorophenyl)piperazin-4-ium-1-carboxamide |
|---|---|
| PubChem CID | 7359826 |
| Molecular Formula | C18H20Cl2N3O+ |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 4-benzyl-N-(3,4-dichlorophenyl)piperazin-4-ium-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)N1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H19Cl2N3O/c19-16-7-6-15(12-17(16)20)21-18(24)23-10-8-22(9-11-23)13-14-4-2-1-3-5-14/h1-7,12H,8-11,13H2,(H,21,24)/p+1 |
| InChIKey | KUKNVTHFRYSYQU-UHFFFAOYSA-O |
| XLogP | 2.93 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |