C13H14Cl2N4O — CID 60971116
4-(cyanomethyl)-N-(3,4-dichlorophenyl)piperazine-1-carboxamide (PubChem CID 60971116) has the molecular formula C13H14Cl2N4O and a molecular weight of 313.19 g/mol. Its IUPAC name is 4-(cyanomethyl)-N-(3,4-dichlorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-(cyanomethyl)-N-(3,4-dichlorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 60971116 |
| Molecular Formula | C13H14Cl2N4O |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 4-(cyanomethyl)-N-(3,4-dichlorophenyl)piperazine-1-carboxamide |
| SMILES | N#CCN1CCN(C(=O)Nc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C13H14Cl2N4O/c14-11-2-1-10(9-12(11)15)17-13(20)19-7-5-18(4-3-16)6-8-19/h1-2,9H,4-8H2,(H,17,20) |
| InChIKey | FTVGGWMLRQWCTC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|