C24H23Cl2N3O — CID 1358692
4-benzhydryl-N-(3,4-dichlorophenyl)piperazine-1-carboxamide (PubChem CID 1358692) has the molecular formula C24H23Cl2N3O and a molecular weight of 440.37 g/mol. Its IUPAC name is 4-benzhydryl-N-(3,4-dichlorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-benzhydryl-N-(3,4-dichlorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 1358692 |
| Molecular Formula | C24H23Cl2N3O |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 4-benzhydryl-N-(3,4-dichlorophenyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H23Cl2N3O/c25-21-12-11-20(17-22(21)26)27-24(30)29-15-13-28(14-16-29)23(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-12,17,23H,13-16H2,(H,27,30) |
| InChIKey | VNNNUWKZMXUHTF-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |