C26H22Cl2N2O — CID 122421177
1-(4-benzhydrylpiperazin-1-yl)-3-(3,4-dichlorophenyl)prop-2-yn-1-one (PubChem CID 122421177) has the molecular formula C26H22Cl2N2O and a molecular weight of 449.38 g/mol. Its IUPAC name is 1-(4-benzhydrylpiperazin-1-yl)-3-(3,4-dichlorophenyl)prop-2-yn-1-one.
| Compound Name | 1-(4-benzhydrylpiperazin-1-yl)-3-(3,4-dichlorophenyl)prop-2-yn-1-one |
|---|---|
| PubChem CID | 122421177 |
| Molecular Formula | C26H22Cl2N2O |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 1-(4-benzhydrylpiperazin-1-yl)-3-(3,4-dichlorophenyl)prop-2-yn-1-one |
| SMILES | O=C(C#Cc1ccc(Cl)c(Cl)c1)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H22Cl2N2O/c27-23-13-11-20(19-24(23)28)12-14-25(31)29-15-17-30(18-16-29)26(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-11,13,19,26H,15-18H2 |
| InChIKey | AIURKCUEMBCAJP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|