C31H27ClN4O — CID 100580549
(4-benzhydrylpiperazin-1-yl)-[4-(6-chloro-1H-benzimidazol-2-yl)phenyl]methanone (PubChem CID 100580549) has the molecular formula C31H27ClN4O and a molecular weight of 507.04 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-1-yl)-[4-(6-chloro-1H-benzimidazol-2-yl)phenyl]methanone.
| Compound Name | (4-benzhydrylpiperazin-1-yl)-[4-(6-chloro-1H-benzimidazol-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 100580549 |
| Molecular Formula | C31H27ClN4O |
| Molecular Weight | 507.04 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | (4-benzhydrylpiperazin-1-yl)-[4-(6-chloro-1H-benzimidazol-2-yl)phenyl]methanone |
| SMILES | O=C(c1ccc(-c2nc3ccc(Cl)cc3[nH]2)cc1)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C31H27ClN4O/c32-26-15-16-27-28(21-26)34-30(33-27)24-11-13-25(14-12-24)31(37)36-19-17-35(18-20-36)29(22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-16,21,29H,17-20H2,(H,33,34) |
| InChIKey | WQKPFSZSQGFJTI-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.04 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |