C28H27N5O2 — CID 66840430
phenyl-[3-[4-(2-phenyl-3H-benzimidazole-5-carbonyl)piperazin-1-yl]azetidin-1-yl]methanone (PubChem CID 66840430) has the molecular formula C28H27N5O2 and a molecular weight of 465.56 g/mol. Its IUPAC name is phenyl-[3-[4-(2-phenyl-3H-benzimidazole-5-carbonyl)piperazin-1-yl]azetidin-1-yl]methanone.
| Compound Name | phenyl-[3-[4-(2-phenyl-3H-benzimidazole-5-carbonyl)piperazin-1-yl]azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 66840430 |
| Molecular Formula | C28H27N5O2 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | phenyl-[3-[4-(2-phenyl-3H-benzimidazole-5-carbonyl)piperazin-1-yl]azetidin-1-yl]methanone |
| SMILES | O=C(c1ccc2nc(-c3ccccc3)[nH]c2c1)N1CCN(C2CN(C(=O)c3ccccc3)C2)CC1 |
| InChI | InChI=1S/C28H27N5O2/c34-27(21-9-5-2-6-10-21)33-18-23(19-33)31-13-15-32(16-14-31)28(35)22-11-12-24-25(17-22)30-26(29-24)20-7-3-1-4-8-20/h1-12,17,23H,13-16,18-19H2,(H,29,30) |
| InChIKey | FNICRFASNWCOBC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 72.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |