C27H26N6O2 — CID 66840009
phenyl-[4-[1-(1-pyrimidin-2-ylindole-5-carbonyl)azetidin-3-yl]piperazin-1-yl]methanone (PubChem CID 66840009) has the molecular formula C27H26N6O2 and a molecular weight of 466.55 g/mol. Its IUPAC name is phenyl-[4-[1-(1-pyrimidin-2-ylindole-5-carbonyl)azetidin-3-yl]piperazin-1-yl]methanone.
| Compound Name | phenyl-[4-[1-(1-pyrimidin-2-ylindole-5-carbonyl)azetidin-3-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 66840009 |
| Molecular Formula | C27H26N6O2 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | phenyl-[4-[1-(1-pyrimidin-2-ylindole-5-carbonyl)azetidin-3-yl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccccc1)N1CCN(C2CN(C(=O)c3ccc4c(ccn4-c4ncccn4)c3)C2)CC1 |
| InChI | InChI=1S/C27H26N6O2/c34-25(20-5-2-1-3-6-20)31-15-13-30(14-16-31)23-18-32(19-23)26(35)22-7-8-24-21(17-22)9-12-33(24)27-28-10-4-11-29-27/h1-12,17,23H,13-16,18-19H2 |
| InChIKey | MSLIIZYFMUXXGE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 74.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |