C28H27N5O2 — CID 66840026
phenyl-[4-[1-(1-pyridin-4-ylindole-5-carbonyl)azetidin-3-yl]piperazin-1-yl]methanone (PubChem CID 66840026) has the molecular formula C28H27N5O2 and a molecular weight of 465.56 g/mol. Its IUPAC name is phenyl-[4-[1-(1-pyridin-4-ylindole-5-carbonyl)azetidin-3-yl]piperazin-1-yl]methanone.
| Compound Name | phenyl-[4-[1-(1-pyridin-4-ylindole-5-carbonyl)azetidin-3-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 66840026 |
| Molecular Formula | C28H27N5O2 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | phenyl-[4-[1-(1-pyridin-4-ylindole-5-carbonyl)azetidin-3-yl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccccc1)N1CCN(C2CN(C(=O)c3ccc4c(ccn4-c4ccncc4)c3)C2)CC1 |
| InChI | InChI=1S/C28H27N5O2/c34-27(21-4-2-1-3-5-21)31-16-14-30(15-17-31)25-19-32(20-25)28(35)23-6-7-26-22(18-23)10-13-33(26)24-8-11-29-12-9-24/h1-13,18,25H,14-17,19-20H2 |
| InChIKey | GXWJPQIRDYZRNV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |