C26H23FN6O2 — CID 66823546
4-[1-[1-(4-fluorophenyl)indole-5-carbonyl]azetidin-3-yl]-1-pyrimidin-2-ylpiperazin-2-one (PubChem CID 66823546) has the molecular formula C26H23FN6O2 and a molecular weight of 470.51 g/mol. Its IUPAC name is 4-[1-[1-(4-fluorophenyl)indole-5-carbonyl]azetidin-3-yl]-1-pyrimidin-2-ylpiperazin-2-one.
| Compound Name | 4-[1-[1-(4-fluorophenyl)indole-5-carbonyl]azetidin-3-yl]-1-pyrimidin-2-ylpiperazin-2-one |
|---|---|
| PubChem CID | 66823546 |
| Molecular Formula | C26H23FN6O2 |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 4-[1-[1-(4-fluorophenyl)indole-5-carbonyl]azetidin-3-yl]-1-pyrimidin-2-ylpiperazin-2-one |
| SMILES | O=C(c1ccc2c(ccn2-c2ccc(F)cc2)c1)N1CC(N2CCN(c3ncccn3)C(=O)C2)C1 |
| InChI | InChI=1S/C26H23FN6O2/c27-20-3-5-21(6-4-20)32-11-8-18-14-19(2-7-23(18)32)25(35)31-15-22(16-31)30-12-13-33(24(34)17-30)26-28-9-1-10-29-26/h1-11,14,22H,12-13,15-17H2 |
| InChIKey | OCIZOKACENCSMN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 74.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |