C26H22FN5O3S — CID 56947705
4-[1-[1-(4-fluorophenyl)indole-5-carbonyl]azetidin-3-yl]-1-(1,3-thiazole-2-carbonyl)piperazin-2-one (PubChem CID 56947705) has the molecular formula C26H22FN5O3S and a molecular weight of 503.56 g/mol. Its IUPAC name is 4-[1-[1-(4-fluorophenyl)indole-5-carbonyl]azetidin-3-yl]-1-(1,3-thiazole-2-carbonyl)piperazin-2-one.
| Compound Name | 4-[1-[1-(4-fluorophenyl)indole-5-carbonyl]azetidin-3-yl]-1-(1,3-thiazole-2-carbonyl)piperazin-2-one |
|---|---|
| PubChem CID | 56947705 |
| Molecular Formula | C26H22FN5O3S |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | 4-[1-[1-(4-fluorophenyl)indole-5-carbonyl]azetidin-3-yl]-1-(1,3-thiazole-2-carbonyl)piperazin-2-one |
| SMILES | O=C(c1ccc2c(ccn2-c2ccc(F)cc2)c1)N1CC(N2CCN(C(=O)c3nccs3)C(=O)C2)C1 |
| InChI | InChI=1S/C26H22FN5O3S/c27-19-2-4-20(5-3-19)31-9-7-17-13-18(1-6-22(17)31)25(34)30-14-21(15-30)29-10-11-32(23(33)16-29)26(35)24-28-8-12-36-24/h1-9,12-13,21H,10-11,14-16H2 |
| InChIKey | QHOCXZGELUXTKU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 78.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|