C27H23FN6O3 — CID 56947704
4-[1-[1-(4-fluorophenyl)indole-5-carbonyl]azetidin-3-yl]-1-(pyrimidine-2-carbonyl)piperazin-2-one (PubChem CID 56947704) has the molecular formula C27H23FN6O3 and a molecular weight of 498.52 g/mol. Its IUPAC name is 4-[1-[1-(4-fluorophenyl)indole-5-carbonyl]azetidin-3-yl]-1-(pyrimidine-2-carbonyl)piperazin-2-one.
| Compound Name | 4-[1-[1-(4-fluorophenyl)indole-5-carbonyl]azetidin-3-yl]-1-(pyrimidine-2-carbonyl)piperazin-2-one |
|---|---|
| PubChem CID | 56947704 |
| Molecular Formula | C27H23FN6O3 |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 4-[1-[1-(4-fluorophenyl)indole-5-carbonyl]azetidin-3-yl]-1-(pyrimidine-2-carbonyl)piperazin-2-one |
| SMILES | O=C(c1ccc2c(ccn2-c2ccc(F)cc2)c1)N1CC(N2CCN(C(=O)c3ncccn3)C(=O)C2)C1 |
| InChI | InChI=1S/C27H23FN6O3/c28-20-3-5-21(6-4-20)33-11-8-18-14-19(2-7-23(18)33)26(36)32-15-22(16-32)31-12-13-34(24(35)17-31)27(37)25-29-9-1-10-30-25/h1-11,14,22H,12-13,15-17H2 |
| InChIKey | VGWRQPNZOHATJW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 91.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|