C19H17N3O2 — CID 137256868
3,6-dihydro-2H-pyridin-1-yl-[2-(4-hydroxyphenyl)-3H-benzimidazol-5-yl]methanone (PubChem CID 137256868) has the molecular formula C19H17N3O2 and a molecular weight of 319.36 g/mol. Its IUPAC name is 3,6-dihydro-2H-pyridin-1-yl-[2-(4-hydroxyphenyl)-3H-benzimidazol-5-yl]methanone.
| Compound Name | 3,6-dihydro-2H-pyridin-1-yl-[2-(4-hydroxyphenyl)-3H-benzimidazol-5-yl]methanone |
|---|---|
| PubChem CID | 137256868 |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 3,6-dihydro-2H-pyridin-1-yl-[2-(4-hydroxyphenyl)-3H-benzimidazol-5-yl]methanone |
| SMILES | O=C(c1ccc2nc(-c3ccc(O)cc3)[nH]c2c1)N1CC=CCC1 |
| InChI | InChI=1S/C19H17N3O2/c23-15-7-4-13(5-8-15)18-20-16-9-6-14(12-17(16)21-18)19(24)22-10-2-1-3-11-22/h1-2,4-9,12,23H,3,10-11H2,(H,20,21) |
| InChIKey | KTBQPVOPTAAFQY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|