C19H17Cl2N3O — CID 25197901
[4-(5,6-dichloro-1H-benzimidazol-2-yl)phenyl]-piperidin-1-ylmethanone (PubChem CID 25197901) has the molecular formula C19H17Cl2N3O and a molecular weight of 374.27 g/mol. Its IUPAC name is [4-(5,6-dichloro-1H-benzimidazol-2-yl)phenyl]-piperidin-1-ylmethanone.
| Compound Name | [4-(5,6-dichloro-1H-benzimidazol-2-yl)phenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 25197901 |
| Molecular Formula | C19H17Cl2N3O |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | [4-(5,6-dichloro-1H-benzimidazol-2-yl)phenyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1ccc(-c2nc3cc(Cl)c(Cl)cc3[nH]2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C19H17Cl2N3O/c20-14-10-16-17(11-15(14)21)23-18(22-16)12-4-6-13(7-5-12)19(25)24-8-2-1-3-9-24/h4-7,10-11H,1-3,8-9H2,(H,22,23) |
| InChIKey | HTQIKQKNAQWVRE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |