C18H18ClN3 — CID 130264624
5-chloro-6-methyl-2-(4-pyrrolidin-1-ylphenyl)-1H-benzimidazole (PubChem CID 130264624) has the molecular formula C18H18ClN3 and a molecular weight of 311.82 g/mol. Its IUPAC name is 5-chloro-6-methyl-2-(4-pyrrolidin-1-ylphenyl)-1H-benzimidazole.
| Compound Name | 5-chloro-6-methyl-2-(4-pyrrolidin-1-ylphenyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 130264624 |
| Molecular Formula | C18H18ClN3 |
| Molecular Weight | 311.82 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 5-chloro-6-methyl-2-(4-pyrrolidin-1-ylphenyl)-1H-benzimidazole |
| SMILES | Cc1cc2[nH]c(-c3ccc(N4CCCC4)cc3)nc2cc1Cl |
| InChI | InChI=1S/C18H18ClN3/c1-12-10-16-17(11-15(12)19)21-18(20-16)13-4-6-14(7-5-13)22-8-2-3-9-22/h4-7,10-11H,2-3,8-9H2,1H3,(H,20,21) |
| InChIKey | JVTPATLIWVHRPJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.82 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|