C19H23ClN4O3+2 — CID 9114365
2-(4-benzylpiperazine-1,4-diium-1-yl)-N-(4-chloro-3-nitrophenyl)acetamide (PubChem CID 9114365) has the molecular formula C19H23ClN4O3+2 and a molecular weight of 390.87 g/mol. Its IUPAC name is 2-(4-benzylpiperazine-1,4-diium-1-yl)-N-(4-chloro-3-nitrophenyl)acetamide.
| Compound Name | 2-(4-benzylpiperazine-1,4-diium-1-yl)-N-(4-chloro-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 9114365 |
| Molecular Formula | C19H23ClN4O3+2 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 2-(4-benzylpiperazine-1,4-diium-1-yl)-N-(4-chloro-3-nitrophenyl)acetamide |
| SMILES | O=C(C[NH+]1CC[NH+](Cc2ccccc2)CC1)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H21ClN4O3/c20-17-7-6-16(12-18(17)24(26)27)21-19(25)14-23-10-8-22(9-11-23)13-15-4-2-1-3-5-15/h1-7,12H,8-11,13-14H2,(H,21,25)/p+2 |
| InChIKey | ZBGRUKWPWMSXIT-UHFFFAOYSA-P |
| XLogP | 0.17 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|