C24H28Cl2N4O2 — CID 11576501
4-(1-benzylpiperidine-4-carbonyl)-N-(3,4-dichlorophenyl)piperazine-1-carboxamide (PubChem CID 11576501) has the molecular formula C24H28Cl2N4O2 and a molecular weight of 475.42 g/mol. Its IUPAC name is 4-(1-benzylpiperidine-4-carbonyl)-N-(3,4-dichlorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-(1-benzylpiperidine-4-carbonyl)-N-(3,4-dichlorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 11576501 |
| Molecular Formula | C24H28Cl2N4O2 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 4-(1-benzylpiperidine-4-carbonyl)-N-(3,4-dichlorophenyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)N1CCN(C(=O)C2CCN(Cc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C24H28Cl2N4O2/c25-21-7-6-20(16-22(21)26)27-24(32)30-14-12-29(13-15-30)23(31)19-8-10-28(11-9-19)17-18-4-2-1-3-5-18/h1-7,16,19H,8-15,17H2,(H,27,32) |
| InChIKey | DHKLMFTVWPYQBG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |