C26H33ClN4O2 — CID 52665658
4-benzyl-N-[3-chloro-4-[cyclohexyl(methyl)carbamoyl]phenyl]piperazine-1-carboxamide (PubChem CID 52665658) has the molecular formula C26H33ClN4O2 and a molecular weight of 469.03 g/mol. Its IUPAC name is 4-benzyl-N-[3-chloro-4-[cyclohexyl(methyl)carbamoyl]phenyl]piperazine-1-carboxamide.
| Compound Name | 4-benzyl-N-[3-chloro-4-[cyclohexyl(methyl)carbamoyl]phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 52665658 |
| Molecular Formula | C26H33ClN4O2 |
| Molecular Weight | 469.03 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 4-benzyl-N-[3-chloro-4-[cyclohexyl(methyl)carbamoyl]phenyl]piperazine-1-carboxamide |
| SMILES | CN(C(=O)c1ccc(NC(=O)N2CCN(Cc3ccccc3)CC2)cc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C26H33ClN4O2/c1-29(22-10-6-3-7-11-22)25(32)23-13-12-21(18-24(23)27)28-26(33)31-16-14-30(15-17-31)19-20-8-4-2-5-9-20/h2,4-5,8-9,12-13,18,22H,3,6-7,10-11,14-17,19H2,1H3,(H,28,33) |
| InChIKey | LASXETFQFUWRFU-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.03 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |