C22H29N3OS — CID 46371875
4-[methyl(propan-2-yl)amino]-N-(4-phenoxyphenyl)piperidine-1-carbothioamide (PubChem CID 46371875) has the molecular formula C22H29N3OS and a molecular weight of 383.56 g/mol. Its IUPAC name is 4-[methyl(propan-2-yl)amino]-N-(4-phenoxyphenyl)piperidine-1-carbothioamide.
| Compound Name | 4-[methyl(propan-2-yl)amino]-N-(4-phenoxyphenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 46371875 |
| Molecular Formula | C22H29N3OS |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 4-[methyl(propan-2-yl)amino]-N-(4-phenoxyphenyl)piperidine-1-carbothioamide |
| SMILES | CC(C)N(C)C1CCN(C(=S)Nc2ccc(Oc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C22H29N3OS/c1-17(2)24(3)19-13-15-25(16-14-19)22(27)23-18-9-11-21(12-10-18)26-20-7-5-4-6-8-20/h4-12,17,19H,13-16H2,1-3H3,(H,23,27) |
| InChIKey | GMXDEWXOSYVSBN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|