C17H27N3S2 — CID 3452632
4-[methyl(propan-2-yl)amino]-N-(3-methylsulfanylphenyl)piperidine-1-carbothioamide (PubChem CID 3452632) has the molecular formula C17H27N3S2 and a molecular weight of 337.56 g/mol. Its IUPAC name is 4-[methyl(propan-2-yl)amino]-N-(3-methylsulfanylphenyl)piperidine-1-carbothioamide.
| Compound Name | 4-[methyl(propan-2-yl)amino]-N-(3-methylsulfanylphenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3452632 |
| Molecular Formula | C17H27N3S2 |
| Molecular Weight | 337.56 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 4-[methyl(propan-2-yl)amino]-N-(3-methylsulfanylphenyl)piperidine-1-carbothioamide |
| SMILES | CSc1cccc(NC(=S)N2CCC(N(C)C(C)C)CC2)c1 |
| InChI | InChI=1S/C17H27N3S2/c1-13(2)19(3)15-8-10-20(11-9-15)17(21)18-14-6-5-7-16(12-14)22-4/h5-7,12-13,15H,8-11H2,1-4H3,(H,18,21) |
| InChIKey | PRLQMJJWUYWCRM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|