C25H30N4O2S2 — CID 3786702
4-[1-[(3,5-dimethoxyphenyl)methyl]imidazol-2-yl]-N-(3-methylsulfanylphenyl)piperidine-1-carbothioamide (PubChem CID 3786702) has the molecular formula C25H30N4O2S2 and a molecular weight of 482.68 g/mol. Its IUPAC name is 4-[1-[(3,5-dimethoxyphenyl)methyl]imidazol-2-yl]-N-(3-methylsulfanylphenyl)piperidine-1-carbothioamide.
| Compound Name | 4-[1-[(3,5-dimethoxyphenyl)methyl]imidazol-2-yl]-N-(3-methylsulfanylphenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3786702 |
| Molecular Formula | C25H30N4O2S2 |
| Molecular Weight | 482.68 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 4-[1-[(3,5-dimethoxyphenyl)methyl]imidazol-2-yl]-N-(3-methylsulfanylphenyl)piperidine-1-carbothioamide |
| SMILES | COc1cc(Cn2ccnc2C2CCN(C(=S)Nc3cccc(SC)c3)CC2)cc(OC)c1 |
| InChI | InChI=1S/C25H30N4O2S2/c1-30-21-13-18(14-22(16-21)31-2)17-29-12-9-26-24(29)19-7-10-28(11-8-19)25(32)27-20-5-4-6-23(15-20)33-3/h4-6,9,12-16,19H,7-8,10-11,17H2,1-3H3,(H,27,32) |
| InChIKey | GDNSKDNVWVONRR-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.68 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|