C27H32N4O4S — CID 3870720
ethyl 3-[[4-[1-[(3,5-dimethoxyphenyl)methyl]imidazol-2-yl]piperidine-1-carbothioyl]amino]benzoate (PubChem CID 3870720) has the molecular formula C27H32N4O4S and a molecular weight of 508.64 g/mol. Its IUPAC name is ethyl 3-[[4-[1-[(3,5-dimethoxyphenyl)methyl]imidazol-2-yl]piperidine-1-carbothioyl]amino]benzoate.
| Compound Name | ethyl 3-[[4-[1-[(3,5-dimethoxyphenyl)methyl]imidazol-2-yl]piperidine-1-carbothioyl]amino]benzoate |
|---|---|
| PubChem CID | 3870720 |
| Molecular Formula | C27H32N4O4S |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | ethyl 3-[[4-[1-[(3,5-dimethoxyphenyl)methyl]imidazol-2-yl]piperidine-1-carbothioyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=S)N2CCC(c3nccn3Cc3cc(OC)cc(OC)c3)CC2)c1 |
| InChI | InChI=1S/C27H32N4O4S/c1-4-35-26(32)21-6-5-7-22(16-21)29-27(36)30-11-8-20(9-12-30)25-28-10-13-31(25)18-19-14-23(33-2)17-24(15-19)34-3/h5-7,10,13-17,20H,4,8-9,11-12,18H2,1-3H3,(H,29,36) |
| InChIKey | HCZQIJQLUCCGGO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|