C24H26ClFN4O2S — CID 3787464
N-(5-chloro-2-fluorophenyl)-4-[1-[(3,5-dimethoxyphenyl)methyl]imidazol-2-yl]piperidine-1-carbothioamide (PubChem CID 3787464) has the molecular formula C24H26ClFN4O2S and a molecular weight of 489.02 g/mol. Its IUPAC name is N-(5-chloro-2-fluorophenyl)-4-[1-[(3,5-dimethoxyphenyl)methyl]imidazol-2-yl]piperidine-1-carbothioamide.
| Compound Name | N-(5-chloro-2-fluorophenyl)-4-[1-[(3,5-dimethoxyphenyl)methyl]imidazol-2-yl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3787464 |
| Molecular Formula | C24H26ClFN4O2S |
| Molecular Weight | 489.02 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | N-(5-chloro-2-fluorophenyl)-4-[1-[(3,5-dimethoxyphenyl)methyl]imidazol-2-yl]piperidine-1-carbothioamide |
| SMILES | COc1cc(Cn2ccnc2C2CCN(C(=S)Nc3cc(Cl)ccc3F)CC2)cc(OC)c1 |
| InChI | InChI=1S/C24H26ClFN4O2S/c1-31-19-11-16(12-20(14-19)32-2)15-30-10-7-27-23(30)17-5-8-29(9-6-17)24(33)28-22-13-18(25)3-4-21(22)26/h3-4,7,10-14,17H,5-6,8-9,15H2,1-2H3,(H,28,33) |
| InChIKey | JRHMXWRVINSQBJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.02 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|