C20H27N5O5S — CID 3697587
4-[1-(2-methoxyethoxymethyl)imidazol-2-yl]-N-(2-methoxy-4-nitrophenyl)piperidine-1-carbothioamide (PubChem CID 3697587) has the molecular formula C20H27N5O5S and a molecular weight of 449.53 g/mol. Its IUPAC name is 4-[1-(2-methoxyethoxymethyl)imidazol-2-yl]-N-(2-methoxy-4-nitrophenyl)piperidine-1-carbothioamide.
| Compound Name | 4-[1-(2-methoxyethoxymethyl)imidazol-2-yl]-N-(2-methoxy-4-nitrophenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3697587 |
| Molecular Formula | C20H27N5O5S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 4-[1-(2-methoxyethoxymethyl)imidazol-2-yl]-N-(2-methoxy-4-nitrophenyl)piperidine-1-carbothioamide |
| SMILES | COCCOCn1ccnc1C1CCN(C(=S)Nc2ccc([N+](=O)[O-])cc2OC)CC1 |
| InChI | InChI=1S/C20H27N5O5S/c1-28-11-12-30-14-24-10-7-21-19(24)15-5-8-23(9-6-15)20(31)22-17-4-3-16(25(26)27)13-18(17)29-2/h3-4,7,10,13,15H,5-6,8-9,11-12,14H2,1-2H3,(H,22,31) |
| InChIKey | RGOAOXMAMJLDDY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 103.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|