C22H27N5O4 — CID 4997518
4-[2-[4-[1-(2-methoxyethoxymethyl)imidazol-2-yl]piperidin-1-yl]-2-oxoethyl]-2H-phthalazin-1-one (PubChem CID 4997518) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is 4-[2-[4-[1-(2-methoxyethoxymethyl)imidazol-2-yl]piperidin-1-yl]-2-oxoethyl]-2H-phthalazin-1-one.
| Compound Name | 4-[2-[4-[1-(2-methoxyethoxymethyl)imidazol-2-yl]piperidin-1-yl]-2-oxoethyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 4997518 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 4-[2-[4-[1-(2-methoxyethoxymethyl)imidazol-2-yl]piperidin-1-yl]-2-oxoethyl]-2H-phthalazin-1-one |
| SMILES | COCCOCn1ccnc1C1CCN(C(=O)Cc2n[nH]c(=O)c3ccccc23)CC1 |
| InChI | InChI=1S/C22H27N5O4/c1-30-12-13-31-15-27-11-8-23-21(27)16-6-9-26(10-7-16)20(28)14-19-17-4-2-3-5-18(17)22(29)25-24-19/h2-5,8,11,16H,6-7,9-10,12-15H2,1H3,(H,25,29) |
| InChIKey | NNZVFVNQBIXWET-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|