C22H29N3O5S — CID 3712587
1-[4-[1-(2-methoxyethoxymethyl)imidazol-2-yl]piperidin-1-yl]-2-(2-phenylethenylsulfonyl)ethanone (PubChem CID 3712587) has the molecular formula C22H29N3O5S and a molecular weight of 447.56 g/mol. Its IUPAC name is 1-[4-[1-(2-methoxyethoxymethyl)imidazol-2-yl]piperidin-1-yl]-2-(2-phenylethenylsulfonyl)ethanone.
| Compound Name | 1-[4-[1-(2-methoxyethoxymethyl)imidazol-2-yl]piperidin-1-yl]-2-(2-phenylethenylsulfonyl)ethanone |
|---|---|
| PubChem CID | 3712587 |
| Molecular Formula | C22H29N3O5S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 1-[4-[1-(2-methoxyethoxymethyl)imidazol-2-yl]piperidin-1-yl]-2-(2-phenylethenylsulfonyl)ethanone |
| SMILES | COCCOCn1ccnc1C1CCN(C(=O)CS(=O)(=O)C=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H29N3O5S/c1-29-14-15-30-18-25-13-10-23-22(25)20-7-11-24(12-8-20)21(26)17-31(27,28)16-9-19-5-3-2-4-6-19/h2-6,9-10,13,16,20H,7-8,11-12,14-15,17-18H2,1H3 |
| InChIKey | MNUHBJBIHUDFLL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|